C24H19N3O3 — CID 169092838
4-(1H-benzimidazol-2-yl)-4-(2-hydroxy-4-methylphenyl)-2-methylisoquinoline-1,3-dione (PubChem CID 169092838) has the molecular formula C24H19N3O3 and a molecular weight of 397.43 g/mol. Its IUPAC name is 4-(1H-benzimidazol-2-yl)-4-(2-hydroxy-4-methylphenyl)-2-methylisoquinoline-1,3-dione.
| Compound Name | 4-(1H-benzimidazol-2-yl)-4-(2-hydroxy-4-methylphenyl)-2-methylisoquinoline-1,3-dione |
|---|---|
| PubChem CID | 169092838 |
| Molecular Formula | C24H19N3O3 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 4-(1H-benzimidazol-2-yl)-4-(2-hydroxy-4-methylphenyl)-2-methylisoquinoline-1,3-dione |
| SMILES | Cc1ccc(C2(c3nc4ccccc4[nH]3)C(=O)N(C)C(=O)c3ccccc32)c(O)c1 |
| InChI | InChI=1S/C24H19N3O3/c1-14-11-12-17(20(28)13-14)24(22-25-18-9-5-6-10-19(18)26-22)16-8-4-3-7-15(16)21(29)27(2)23(24)30/h3-13,28H,1-2H3,(H,25,26) |
| InChIKey | RQGRQIQGGGCDPK-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|