C10H17N — CID 169095034
2-azatricyclo[5.2.2.01,4]undecane (PubChem CID 169095034) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is 2-azatricyclo[5.2.2.01,4]undecane.
| Compound Name | 2-azatricyclo[5.2.2.01,4]undecane |
|---|---|
| PubChem CID | 169095034 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 2-azatricyclo[5.2.2.01,4]undecane |
| SMILES | C1CC2CNC23CCC1CC3 |
| InChI | InChI=1S/C10H17N/c1-2-9-7-11-10(9)5-3-8(1)4-6-10/h8-9,11H,1-7H2 |
| InChIKey | ZFCHNRPAMHOERQ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |