C7H11N — CID 123313654
7-azatricyclo[3.2.1.01,4]octane (PubChem CID 123313654) has the molecular formula C7H11N and a molecular weight of 109.17 g/mol. Its IUPAC name is 7-azatricyclo[3.2.1.01,4]octane.
| Compound Name | 7-azatricyclo[3.2.1.01,4]octane |
|---|---|
| PubChem CID | 123313654 |
| Molecular Formula | C7H11N |
| Molecular Weight | 109.17 g/mol |
| Exact Mass | 109.09 |
| IUPAC Name | 7-azatricyclo[3.2.1.01,4]octane |
| SMILES | C1NC23CCC2C1C3 |
| InChI | InChI=1S/C7H11N/c1-2-7-3-5(4-8-7)6(1)7/h5-6,8H,1-4H2 |
| InChIKey | GFVPSOPHTMORKM-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 109.17 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |