C8H12 — CID 90707927
tricyclo[3.2.1.01,4]octane (PubChem CID 90707927) has the molecular formula C8H12 and a molecular weight of 108.18 g/mol. Its IUPAC name is tricyclo[3.2.1.01,4]octane.
| Compound Name | tricyclo[3.2.1.01,4]octane |
|---|---|
| PubChem CID | 90707927 |
| Molecular Formula | C8H12 |
| Molecular Weight | 108.18 g/mol |
| Exact Mass | 108.09 |
| IUPAC Name | tricyclo[3.2.1.01,4]octane |
| SMILES | C1CC23CCC2C1C3 |
| InChI | InChI=1S/C8H12/c1-3-8-4-2-7(8)6(1)5-8/h6-7H,1-5H2 |
| InChIKey | ZJHLPURETVPRTJ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 108.18 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |