About 8,11-dimethylpentacyclo[11.2.1.01,12.03,8.04,7]hexadecane
8,11-dimethylpentacyclo[11.2.1.01,12.03,8.04,7]hexadecane (PubChem CID 123369397) has the molecular formula C18H28
and a molecular weight of 244.42 g/mol. Its IUPAC name is 8,11-dimethylpentacyclo[11.2.1.01,12.03,8.04,7]hexadecane.
Analyze 8,11-dimethylpentacyclo[11.2.1.01,12.03,8.04,7]hexadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8,11-dimethylpentacyclo[11.2.1.01,12.03,8.04,7]hexadecane?
The IUPAC name of 8,11-dimethylpentacyclo[11.2.1.01,12.03,8.04,7]hexadecane (CID 123369397) is 8,11-dimethylpentacyclo[11.2.1.01,12.03,8.04,7]hexadecane.
What is the SMILES notation for 8,11-dimethylpentacyclo[11.2.1.01,12.03,8.04,7]hexadecane?
The canonical SMILES for 8,11-dimethylpentacyclo[11.2.1.01,12.03,8.04,7]hexadecane is CC1CCC2(C)C3CCC3C2CC23CCC(C2)C13.
What is the InChIKey of 8,11-dimethylpentacyclo[11.2.1.01,12.03,8.04,7]hexadecane?
The InChIKey is RUZZRPFGJMPGHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28/c1-11-5-7-17(2)14-4-3-13(14)15(17)10-18-8-6-12(9-18)16(11)18/h11-16H,3-10H2,1-2H3.
What are the key properties of 8,11-dimethylpentacyclo[11.2.1.01,12.03,8.04,7]hexadecane?
8,11-dimethylpentacyclo[11.2.1.01,12.03,8.04,7]hexadecane has a molecular weight of 244.42 g/mol, XLogP of 4.89, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 8,11-dimethylpentacyclo[11.2.1.01,12.03,8.04,7]hexadecane is sourced from PubChem (CID 123369397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).