C15H26O3 — CID 102197938
(1S,2aS,5R,5aS,8R,8aR,8bR)-5-(hydroxymethyl)-1,8-dimethyl-2,2a,3,4,5a,6,7,8,8a,8b-decahydrocyclobuta[e]azulene-1,5-diol (PubChem CID 102197938) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is (1S,2aS,5R,5aS,8R,8aR,8bR)-5-(hydroxymethyl)-1,8-dimethyl-2,2a,3,4,5a,6,7,8,8a,8b-decahydrocyclobuta[e]azulene-1,5-diol.
| Compound Name | (1S,2aS,5R,5aS,8R,8aR,8bR)-5-(hydroxymethyl)-1,8-dimethyl-2,2a,3,4,5a,6,7,8,8a,8b-decahydrocyclobuta[e]azulene-1,5-diol |
|---|---|
| PubChem CID | 102197938 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | (1S,2aS,5R,5aS,8R,8aR,8bR)-5-(hydroxymethyl)-1,8-dimethyl-2,2a,3,4,5a,6,7,8,8a,8b-decahydrocyclobuta[e]azulene-1,5-diol |
| SMILES | C[C@@H]1CC[C@H]2[C@@H]1[C@H]1[C@@H](CC[C@]2(O)CO)C[C@]1(C)O |
| InChI | InChI=1S/C15H26O3/c1-9-3-4-11-12(9)13-10(7-14(13,2)17)5-6-15(11,18)8-16/h9-13,16-18H,3-8H2,1-2H3/t9-,10+,11+,12-,13-,14+,15+/m1/s1 |
| InChIKey | UKYWDUBYSGXKRC-SGASCXMQSA-N |
| XLogP | 1.55 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |