C16H15ClN4O — CID 169095221
7-chloro-2-(4-methylpiperazin-1-yl)indeno[2,1-d]pyrimidin-9-one (PubChem CID 169095221) has the molecular formula C16H15ClN4O and a molecular weight of 314.78 g/mol. Its IUPAC name is 7-chloro-2-(4-methylpiperazin-1-yl)indeno[2,1-d]pyrimidin-9-one.
| Compound Name | 7-chloro-2-(4-methylpiperazin-1-yl)indeno[2,1-d]pyrimidin-9-one |
|---|---|
| PubChem CID | 169095221 |
| Molecular Formula | C16H15ClN4O |
| Molecular Weight | 314.78 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 7-chloro-2-(4-methylpiperazin-1-yl)indeno[2,1-d]pyrimidin-9-one |
| SMILES | CN1CCN(c2ncc3c(n2)C(=O)c2cc(Cl)ccc2-3)CC1 |
| InChI | InChI=1S/C16H15ClN4O/c1-20-4-6-21(7-5-20)16-18-9-13-11-3-2-10(17)8-12(11)15(22)14(13)19-16/h2-3,8-9H,4-7H2,1H3 |
| InChIKey | QJGQJFFQFUXZLC-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.78 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |