C17H20OS — CID 169095841
2-[(E)-2-(1-benzothiophen-2-yl)ethenyl]-4,4-dimethyloxane (PubChem CID 169095841) has the molecular formula C17H20OS and a molecular weight of 272.41 g/mol. Its IUPAC name is 2-[(E)-2-(1-benzothiophen-2-yl)ethenyl]-4,4-dimethyloxane.
| Compound Name | 2-[(E)-2-(1-benzothiophen-2-yl)ethenyl]-4,4-dimethyloxane |
|---|---|
| PubChem CID | 169095841 |
| Molecular Formula | C17H20OS |
| Molecular Weight | 272.41 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 2-[(E)-2-(1-benzothiophen-2-yl)ethenyl]-4,4-dimethyloxane |
| SMILES | CC1(C)CCOC(/C=C/c2cc3ccccc3s2)C1 |
| InChI | InChI=1S/C17H20OS/c1-17(2)9-10-18-14(12-17)7-8-15-11-13-5-3-4-6-16(13)19-15/h3-8,11,14H,9-10,12H2,1-2H3/b8-7+ |
| InChIKey | LDWLPIHANDRQAO-BQYQJAHWSA-N |
| XLogP | 5.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.41 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |