About 2-[(E)-2-(1-benzothiophen-2-yl)ethenyl]-4,4-dimethyloxane
2-[(E)-2-(1-benzothiophen-2-yl)ethenyl]-4,4-dimethyloxane (PubChem CID 169095841) has the molecular formula C17H20OS
and a molecular weight of 272.41 g/mol. Its IUPAC name is 2-[(E)-2-(1-benzothiophen-2-yl)ethenyl]-4,4-dimethyloxane.
Molecular Properties
| Compound Name | 2-[(E)-2-(1-benzothiophen-2-yl)ethenyl]-4,4-dimethyloxane |
| PubChem CID | 169095841 |
| Molecular Formula | C17H20OS |
| Molecular Weight | 272.41 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 2-[(E)-2-(1-benzothiophen-2-yl)ethenyl]-4,4-dimethyloxane |
| SMILES | CC1(C)CCOC(/C=C/c2cc3ccccc3s2)C1 |
| InChI | InChI=1S/C17H20OS/c1-17(2)9-10-18-14(12-17)7-8-15-11-13-5-3-4-6-16(13)19-15/h3-8,11,14H,9-10,12H2,1-2H3/b8-7+ |
| InChIKey | LDWLPIHANDRQAO-BQYQJAHWSA-N |
| XLogP | 5.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 272.41 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(E)-2-(1-benzothiophen-2-yl)ethenyl]-4,4-dimethyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-2-(1-benzothiophen-2-yl)ethenyl]-4,4-dimethyloxane?
The IUPAC name of 2-[(E)-2-(1-benzothiophen-2-yl)ethenyl]-4,4-dimethyloxane (CID 169095841) is 2-[(E)-2-(1-benzothiophen-2-yl)ethenyl]-4,4-dimethyloxane.
What is the SMILES notation for 2-[(E)-2-(1-benzothiophen-2-yl)ethenyl]-4,4-dimethyloxane?
The canonical SMILES for 2-[(E)-2-(1-benzothiophen-2-yl)ethenyl]-4,4-dimethyloxane is CC1(C)CCOC(/C=C/c2cc3ccccc3s2)C1.
What is the InChIKey of 2-[(E)-2-(1-benzothiophen-2-yl)ethenyl]-4,4-dimethyloxane?
The InChIKey is LDWLPIHANDRQAO-BQYQJAHWSA-N. The full InChI is InChI=1S/C17H20OS/c1-17(2)9-10-18-14(12-17)7-8-15-11-13-5-3-4-6-16(13)19-15/h3-8,11,14H,9-10,12H2,1-2H3/b8-7+.
What are the key properties of 2-[(E)-2-(1-benzothiophen-2-yl)ethenyl]-4,4-dimethyloxane?
2-[(E)-2-(1-benzothiophen-2-yl)ethenyl]-4,4-dimethyloxane has a molecular weight of 272.41 g/mol, XLogP of 5.12, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-2-(1-benzothiophen-2-yl)ethenyl]-4,4-dimethyloxane is sourced from PubChem (CID 169095841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).