C21H24N2O5 — CID 169098182
4-[2-methoxy-4-[(E)-3-(3,5,6-trimethylpyrazin-2-yl)prop-2-enoyl]phenoxy]butanoic acid (PubChem CID 169098182) has the molecular formula C21H24N2O5 and a molecular weight of 384.43 g/mol. Its IUPAC name is 4-[2-methoxy-4-[(E)-3-(3,5,6-trimethylpyrazin-2-yl)prop-2-enoyl]phenoxy]butanoic acid.
| Compound Name | 4-[2-methoxy-4-[(E)-3-(3,5,6-trimethylpyrazin-2-yl)prop-2-enoyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 169098182 |
| Molecular Formula | C21H24N2O5 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 4-[2-methoxy-4-[(E)-3-(3,5,6-trimethylpyrazin-2-yl)prop-2-enoyl]phenoxy]butanoic acid |
| SMILES | COc1cc(C(=O)/C=C/c2nc(C)c(C)nc2C)ccc1OCCCC(=O)O |
| InChI | InChI=1S/C21H24N2O5/c1-13-14(2)23-17(15(3)22-13)8-9-18(24)16-7-10-19(20(12-16)27-4)28-11-5-6-21(25)26/h7-10,12H,5-6,11H2,1-4H3,(H,25,26)/b9-8+ |
| InChIKey | DWCQDGQXYDDNHJ-CMDGGOBGSA-N |
| XLogP | 3.55 |
| TPSA | 98.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|