C19H18N2O5S — CID 55471048
2-[4-[(E)-3-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoyl]-2-methoxyphenoxy]acetic acid (PubChem CID 55471048) has the molecular formula C19H18N2O5S and a molecular weight of 386.43 g/mol. Its IUPAC name is 2-[4-[(E)-3-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoyl]-2-methoxyphenoxy]acetic acid.
| Compound Name | 2-[4-[(E)-3-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoyl]-2-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 55471048 |
| Molecular Formula | C19H18N2O5S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | 2-[4-[(E)-3-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoyl]-2-methoxyphenoxy]acetic acid |
| SMILES | COc1cc(C(=O)/C=C/c2c(C)nc3sc(C)cn23)ccc1OCC(=O)O |
| InChI | InChI=1S/C19H18N2O5S/c1-11-9-21-14(12(2)20-19(21)27-11)5-6-15(22)13-4-7-16(17(8-13)25-3)26-10-18(23)24/h4-9H,10H2,1-3H3,(H,23,24)/b6-5+ |
| InChIKey | SFSZHLRUIGBYQI-AATRIKPKSA-N |
| XLogP | 3.38 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|