C16H12F2N2OS — CID 76855112
1-(2,4-difluorophenyl)-3-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-en-1-one (PubChem CID 76855112) has the molecular formula C16H12F2N2OS and a molecular weight of 318.35 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-en-1-one.
| Compound Name | 1-(2,4-difluorophenyl)-3-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 76855112 |
| Molecular Formula | C16H12F2N2OS |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-en-1-one |
| SMILES | Cc1cn2c(C=CC(=O)c3ccc(F)cc3F)c(C)nc2s1 |
| InChI | InChI=1S/C16H12F2N2OS/c1-9-8-20-14(10(2)19-16(20)22-9)5-6-15(21)12-4-3-11(17)7-13(12)18/h3-8H,1-2H3 |
| InChIKey | MLCOUXPEQHHJQQ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|