C17H14F3N3OS — CID 24559408
(E)-3-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)-N-[3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 24559408) has the molecular formula C17H14F3N3OS and a molecular weight of 365.38 g/mol. Its IUPAC name is (E)-3-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)-N-[3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)-N-[3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 24559408 |
| Molecular Formula | C17H14F3N3OS |
| Molecular Weight | 365.38 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | (E)-3-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)-N-[3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | Cc1cn2c(/C=C/C(=O)Nc3cccc(C(F)(F)F)c3)c(C)nc2s1 |
| InChI | InChI=1S/C17H14F3N3OS/c1-10-9-23-14(11(2)21-16(23)25-10)6-7-15(24)22-13-5-3-4-12(8-13)17(18,19)20/h3-9H,1-2H3,(H,22,24)/b7-6+ |
| InChIKey | ILGYVNGXGPERPR-VOTSOKGWSA-N |
| XLogP | 4.68 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.38 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|