C20H19N5OS — CID 24617864
(E)-3-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)-N-[(1-phenylpyrazol-4-yl)methyl]prop-2-enamide (PubChem CID 24617864) has the molecular formula C20H19N5OS and a molecular weight of 377.47 g/mol. Its IUPAC name is (E)-3-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)-N-[(1-phenylpyrazol-4-yl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)-N-[(1-phenylpyrazol-4-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 24617864 |
| Molecular Formula | C20H19N5OS |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | (E)-3-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)-N-[(1-phenylpyrazol-4-yl)methyl]prop-2-enamide |
| SMILES | Cc1cn2c(/C=C/C(=O)NCc3cnn(-c4ccccc4)c3)c(C)nc2s1 |
| InChI | InChI=1S/C20H19N5OS/c1-14-12-24-18(15(2)23-20(24)27-14)8-9-19(26)21-10-16-11-22-25(13-16)17-6-4-3-5-7-17/h3-9,11-13H,10H2,1-2H3,(H,21,26)/b9-8+ |
| InChIKey | MTHKJVWUNVRKLM-CMDGGOBGSA-N |
| XLogP | 3.53 |
| TPSA | 64.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|