C20H21N5OS — CID 25358407
(E)-N-[3-(benzimidazol-1-yl)propyl]-3-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enamide (PubChem CID 25358407) has the molecular formula C20H21N5OS and a molecular weight of 379.49 g/mol. Its IUPAC name is (E)-N-[3-(benzimidazol-1-yl)propyl]-3-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enamide.
| Compound Name | (E)-N-[3-(benzimidazol-1-yl)propyl]-3-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 25358407 |
| Molecular Formula | C20H21N5OS |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | (E)-N-[3-(benzimidazol-1-yl)propyl]-3-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enamide |
| SMILES | Cc1cn2c(/C=C/C(=O)NCCCn3cnc4ccccc43)c(C)nc2s1 |
| InChI | InChI=1S/C20H21N5OS/c1-14-12-25-17(15(2)23-20(25)27-14)8-9-19(26)21-10-5-11-24-13-22-16-6-3-4-7-18(16)24/h3-4,6-9,12-13H,5,10-11H2,1-2H3,(H,21,26)/b9-8+ |
| InChIKey | UNJNJLJLYTXUHC-CMDGGOBGSA-N |
| XLogP | 3.58 |
| TPSA | 64.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|