C18H16N4O2S — CID 24559941
(E)-N-[4-(cyanomethoxy)phenyl]-3-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enamide (PubChem CID 24559941) has the molecular formula C18H16N4O2S and a molecular weight of 352.42 g/mol. Its IUPAC name is (E)-N-[4-(cyanomethoxy)phenyl]-3-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enamide.
| Compound Name | (E)-N-[4-(cyanomethoxy)phenyl]-3-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 24559941 |
| Molecular Formula | C18H16N4O2S |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | (E)-N-[4-(cyanomethoxy)phenyl]-3-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enamide |
| SMILES | Cc1cn2c(/C=C/C(=O)Nc3ccc(OCC#N)cc3)c(C)nc2s1 |
| InChI | InChI=1S/C18H16N4O2S/c1-12-11-22-16(13(2)20-18(22)25-12)7-8-17(23)21-14-3-5-15(6-4-14)24-10-9-19/h3-8,11H,10H2,1-2H3,(H,21,23)/b8-7+ |
| InChIKey | KWAYQMUSYBQKIB-BQYQJAHWSA-N |
| XLogP | 3.57 |
| TPSA | 79.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|