C17H16N4O2S — CID 24559446
N'-[(E)-3-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoyl]benzohydrazide (PubChem CID 24559446) has the molecular formula C17H16N4O2S and a molecular weight of 340.41 g/mol. Its IUPAC name is N'-[(E)-3-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoyl]benzohydrazide.
| Compound Name | N'-[(E)-3-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoyl]benzohydrazide |
|---|---|
| PubChem CID | 24559446 |
| Molecular Formula | C17H16N4O2S |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | N'-[(E)-3-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoyl]benzohydrazide |
| SMILES | Cc1cn2c(/C=C/C(=O)NNC(=O)c3ccccc3)c(C)nc2s1 |
| InChI | InChI=1S/C17H16N4O2S/c1-11-10-21-14(12(2)18-17(21)24-11)8-9-15(22)19-20-16(23)13-6-4-3-5-7-13/h3-10H,1-2H3,(H,19,22)(H,20,23)/b9-8+ |
| InChIKey | FQMSHWMZGXKRNA-CMDGGOBGSA-N |
| XLogP | 2.49 |
| TPSA | 75.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|