About 3-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)-2-methylprop-2-enal
3-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)-2-methylprop-2-enal (PubChem CID 79330689) has the molecular formula C11H12N2OS
and a molecular weight of 220.30 g/mol. Its IUPAC name is 3-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)-2-methylprop-2-enal.
Molecular Properties
| Compound Name | 3-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)-2-methylprop-2-enal |
| PubChem CID | 79330689 |
| Molecular Formula | C11H12N2OS |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 3-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)-2-methylprop-2-enal |
| SMILES | CC(C=O)=Cc1c(C)nc2sc(C)cn12 |
| InChI | InChI=1S/C11H12N2OS/c1-7(6-14)4-10-9(3)12-11-13(10)5-8(2)15-11/h4-6H,1-3H3 |
| InChIKey | YALJLSHFDZRSQN-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)-2-methylprop-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)-2-methylprop-2-enal?
The IUPAC name of 3-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)-2-methylprop-2-enal (CID 79330689) is 3-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)-2-methylprop-2-enal.
What is the SMILES notation for 3-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)-2-methylprop-2-enal?
The canonical SMILES for 3-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)-2-methylprop-2-enal is CC(C=O)=Cc1c(C)nc2sc(C)cn12.
What is the InChIKey of 3-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)-2-methylprop-2-enal?
The InChIKey is YALJLSHFDZRSQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2OS/c1-7(6-14)4-10-9(3)12-11-13(10)5-8(2)15-11/h4-6H,1-3H3.
What are the key properties of 3-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)-2-methylprop-2-enal?
3-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)-2-methylprop-2-enal has a molecular weight of 220.30 g/mol, XLogP of 2.61, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)-2-methylprop-2-enal is sourced from PubChem (CID 79330689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).