C19H13FN2O2S — CID 70896457
3-[6-(4-fluorophenyl)-2-methylimidazo[2,1-b][1,3]thiazol-5-yl]-1-(furan-2-yl)prop-2-en-1-one (PubChem CID 70896457) has the molecular formula C19H13FN2O2S and a molecular weight of 352.39 g/mol. Its IUPAC name is 3-[6-(4-fluorophenyl)-2-methylimidazo[2,1-b][1,3]thiazol-5-yl]-1-(furan-2-yl)prop-2-en-1-one.
| Compound Name | 3-[6-(4-fluorophenyl)-2-methylimidazo[2,1-b][1,3]thiazol-5-yl]-1-(furan-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 70896457 |
| Molecular Formula | C19H13FN2O2S |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | 3-[6-(4-fluorophenyl)-2-methylimidazo[2,1-b][1,3]thiazol-5-yl]-1-(furan-2-yl)prop-2-en-1-one |
| SMILES | Cc1cn2c(C=CC(=O)c3ccco3)c(-c3ccc(F)cc3)nc2s1 |
| InChI | InChI=1S/C19H13FN2O2S/c1-12-11-22-15(8-9-16(23)17-3-2-10-24-17)18(21-19(22)25-12)13-4-6-14(20)7-5-13/h2-11H,1H3 |
| InChIKey | GSYOPJKIERPDHV-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 47.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|