C7H10O5 — CID 169098460
(2R,3R)-5-deuterio-3-[(1R)-1,2-dihydroxyethyl]-2,3-dihydroxypent-4-ynal (PubChem CID 169098460) has the molecular formula C7H10O5 and a molecular weight of 175.16 g/mol. Its IUPAC name is (2R,3R)-5-deuterio-3-[(1R)-1,2-dihydroxyethyl]-2,3-dihydroxypent-4-ynal.
| Compound Name | (2R,3R)-5-deuterio-3-[(1R)-1,2-dihydroxyethyl]-2,3-dihydroxypent-4-ynal |
|---|---|
| PubChem CID | 169098460 |
| Molecular Formula | C7H10O5 |
| Molecular Weight | 175.16 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | (2R,3R)-5-deuterio-3-[(1R)-1,2-dihydroxyethyl]-2,3-dihydroxypent-4-ynal |
| SMILES | [2H]C#C[C@@](O)([C@H](O)CO)[C@@H](O)C=O |
| InChI | InChI=1S/C7H10O5/c1-2-7(12,5(10)3-8)6(11)4-9/h1,3,5-6,9-12H,4H2/t5-,6+,7-/m0/s1/i1D |
| InChIKey | SKOFPLFAGZSYFM-IXVHPVLFSA-N |
| XLogP | -2.74 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.16 |
| LogP ≤ 5 | -2.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|