C21H19F3N4O2S — CID 169098666
13-[(3S,4S)-4-(3,4,5-trifluorophenyl)piperidin-3-yl]-9-oxa-11-thia-5,6-diazatricyclo[8.3.0.02,6]trideca-1(10),2,4,12-tetraene-12-carboxamide (PubChem CID 169098666) has the molecular formula C21H19F3N4O2S and a molecular weight of 448.47 g/mol. Its IUPAC name is 13-[(3S,4S)-4-(3,4,5-trifluorophenyl)piperidin-3-yl]-9-oxa-11-thia-5,6-diazatricyclo[8.3.0.02,6]trideca-1(10),2,4,12-tetraene-12-carboxamide.
| Compound Name | 13-[(3S,4S)-4-(3,4,5-trifluorophenyl)piperidin-3-yl]-9-oxa-11-thia-5,6-diazatricyclo[8.3.0.02,6]trideca-1(10),2,4,12-tetraene-12-carboxamide |
|---|---|
| PubChem CID | 169098666 |
| Molecular Formula | C21H19F3N4O2S |
| Molecular Weight | 448.47 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | 13-[(3S,4S)-4-(3,4,5-trifluorophenyl)piperidin-3-yl]-9-oxa-11-thia-5,6-diazatricyclo[8.3.0.02,6]trideca-1(10),2,4,12-tetraene-12-carboxamide |
| SMILES | NC(=O)c1sc2c(c1[C@H]1CNCC[C@@H]1c1cc(F)c(F)c(F)c1)-c1ccnn1CCO2 |
| InChI | InChI=1S/C21H19F3N4O2S/c22-13-7-10(8-14(23)18(13)24)11-1-3-26-9-12(11)16-17-15-2-4-27-28(15)5-6-30-21(17)31-19(16)20(25)29/h2,4,7-8,11-12,26H,1,3,5-6,9H2,(H2,25,29)/t11-,12+/m1/s1 |
| InChIKey | UMIXBSQMHRTGHL-NEPJUHHUSA-N |
| XLogP | 3.38 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.47 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|