C30H52O2 — CID 169103287
(5R,10S,13R,17R)-17-[(2R)-6-hydroxy-6-methylheptan-2-yl]-3,4,4,10,13-pentamethyl-2,5,6,7,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 169103287) has the molecular formula C30H52O2 and a molecular weight of 444.74 g/mol. Its IUPAC name is (5R,10S,13R,17R)-17-[(2R)-6-hydroxy-6-methylheptan-2-yl]-3,4,4,10,13-pentamethyl-2,5,6,7,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (5R,10S,13R,17R)-17-[(2R)-6-hydroxy-6-methylheptan-2-yl]-3,4,4,10,13-pentamethyl-2,5,6,7,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 169103287 |
| Molecular Formula | C30H52O2 |
| Molecular Weight | 444.74 g/mol |
| Exact Mass | 444.40 |
| IUPAC Name | (5R,10S,13R,17R)-17-[(2R)-6-hydroxy-6-methylheptan-2-yl]-3,4,4,10,13-pentamethyl-2,5,6,7,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@H](CCCC(C)(C)O)[C@H]1CCC2C3=C(CC[C@@]21C)[C@@]1(C)CCC(C)(O)C(C)(C)[C@@H]1CC3 |
| InChI | InChI=1S/C30H52O2/c1-20(10-9-16-26(2,3)31)22-12-13-23-21-11-14-25-27(4,5)30(8,32)19-18-29(25,7)24(21)15-17-28(22,23)6/h20,22-23,25,31-32H,9-19H2,1-8H3/t20-,22-,23?,25+,28-,29-,30?/m1/s1 |
| InChIKey | XPLJZCVGOQZXRQ-VTMFGUKISA-N |
| XLogP | 7.67 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.74 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|