C60H62N4O3 — CID 169103827
buta-1,3-dien-2-ol;1-[4-[3,3,10-tris(4-pyrrolidin-1-ylphenyl)chromeno[5,6-f]chromen-10-yl]phenyl]pyrrolidine (PubChem CID 169103827) has the molecular formula C60H62N4O3 and a molecular weight of 887.18 g/mol. Its IUPAC name is buta-1,3-dien-2-ol;1-[4-[3,3,10-tris(4-pyrrolidin-1-ylphenyl)chromeno[5,6-f]chromen-10-yl]phenyl]pyrrolidine.
| Compound Name | buta-1,3-dien-2-ol;1-[4-[3,3,10-tris(4-pyrrolidin-1-ylphenyl)chromeno[5,6-f]chromen-10-yl]phenyl]pyrrolidine |
|---|---|
| PubChem CID | 169103827 |
| Molecular Formula | C60H62N4O3 |
| Molecular Weight | 887.18 g/mol |
| Exact Mass | 886.48 |
| IUPAC Name | buta-1,3-dien-2-ol;1-[4-[3,3,10-tris(4-pyrrolidin-1-ylphenyl)chromeno[5,6-f]chromen-10-yl]phenyl]pyrrolidine |
| SMILES | C1=CC(c2ccc(N3CCCC3)cc2)(c2ccc(N3CCCC3)cc2)Oc2ccc3ccc4c(c3c21)C=CC(c1ccc(N2CCCC2)cc1)(c1ccc(N2CCCC2)cc1)O4.C=CC(=C)O |
| InChI | InChI=1S/C56H56N4O2.C4H6O/c1-2-34-57(33-1)46-19-11-42(12-20-46)55(43-13-21-47(22-14-43)58-35-3-4-36-58)31-29-50-52(61-55)27-9-41-10-28-53-51(54(41)50)30-32-56(62-53,44-15-23-48(24-16-44)59-37-5-6-38-59)45-17-25-49(26-18-45)60-39-7-8-40-60;1-3-4(2)5/h9-32H,1-8,33-40H2;3,5H,1-2H2 |
| InChIKey | LDSYXTUINKFWGI-UHFFFAOYSA-N |
| XLogP | 13.18 |
| TPSA | 51.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 887.18 |
| LogP ≤ 5 | 13.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|