C28H29NO2 — CID 169103817
1-[4-[3-[(E)-but-2-en-2-yl]-8-methoxybenzo[f]chromen-3-yl]phenyl]pyrrolidine (PubChem CID 169103817) has the molecular formula C28H29NO2 and a molecular weight of 411.55 g/mol. Its IUPAC name is 1-[4-[3-[(E)-but-2-en-2-yl]-8-methoxybenzo[f]chromen-3-yl]phenyl]pyrrolidine.
| Compound Name | 1-[4-[3-[(E)-but-2-en-2-yl]-8-methoxybenzo[f]chromen-3-yl]phenyl]pyrrolidine |
|---|---|
| PubChem CID | 169103817 |
| Molecular Formula | C28H29NO2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | 1-[4-[3-[(E)-but-2-en-2-yl]-8-methoxybenzo[f]chromen-3-yl]phenyl]pyrrolidine |
| SMILES | C/C=C(\C)C1(c2ccc(N3CCCC3)cc2)C=Cc2c(ccc3cc(OC)ccc23)O1 |
| InChI | InChI=1S/C28H29NO2/c1-4-20(2)28(22-8-10-23(11-9-22)29-17-5-6-18-29)16-15-26-25-13-12-24(30-3)19-21(25)7-14-27(26)31-28/h4,7-16,19H,5-6,17-18H2,1-3H3/b20-4+ |
| InChIKey | VSUWADLSAWZRMR-LRNAUUFOSA-N |
| XLogP | 6.72 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|