C29H39NO — CID 169105878
(9Z)-5,9-dimethyl-8-(methylamino)-10,11-bis(4-methylphenyl)dodeca-9,11-dien-4-one (PubChem CID 169105878) has the molecular formula C29H39NO and a molecular weight of 417.64 g/mol. Its IUPAC name is (9Z)-5,9-dimethyl-8-(methylamino)-10,11-bis(4-methylphenyl)dodeca-9,11-dien-4-one.
| Compound Name | (9Z)-5,9-dimethyl-8-(methylamino)-10,11-bis(4-methylphenyl)dodeca-9,11-dien-4-one |
|---|---|
| PubChem CID | 169105878 |
| Molecular Formula | C29H39NO |
| Molecular Weight | 417.64 g/mol |
| Exact Mass | 417.30 |
| IUPAC Name | (9Z)-5,9-dimethyl-8-(methylamino)-10,11-bis(4-methylphenyl)dodeca-9,11-dien-4-one |
| SMILES | C=C(/C(=C(/C)C(CCC(C)C(=O)CCC)NC)c1ccc(C)cc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C29H39NO/c1-8-9-28(31)22(4)14-19-27(30-7)24(6)29(26-17-12-21(3)13-18-26)23(5)25-15-10-20(2)11-16-25/h10-13,15-18,22,27,30H,5,8-9,14,19H2,1-4,6-7H3/b29-24+ |
| InChIKey | LWVMEKZBIUZADF-RMLRFSFXSA-N |
| XLogP | 7.16 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.64 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|