C24H30N2OS — CID 176689435
2-[(2Z)-2-methyl-1-(methylamino)-3,4-bis(4-methylphenyl)penta-2,4-dienyl]sulfanylpropanamide (PubChem CID 176689435) has the molecular formula C24H30N2OS and a molecular weight of 394.58 g/mol. Its IUPAC name is 2-[(2Z)-2-methyl-1-(methylamino)-3,4-bis(4-methylphenyl)penta-2,4-dienyl]sulfanylpropanamide.
| Compound Name | 2-[(2Z)-2-methyl-1-(methylamino)-3,4-bis(4-methylphenyl)penta-2,4-dienyl]sulfanylpropanamide |
|---|---|
| PubChem CID | 176689435 |
| Molecular Formula | C24H30N2OS |
| Molecular Weight | 394.58 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | 2-[(2Z)-2-methyl-1-(methylamino)-3,4-bis(4-methylphenyl)penta-2,4-dienyl]sulfanylpropanamide |
| SMILES | C=C(/C(=C(/C)C(NC)SC(C)C(N)=O)c1ccc(C)cc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H30N2OS/c1-15-7-11-20(12-8-15)17(3)22(21-13-9-16(2)10-14-21)18(4)24(26-6)28-19(5)23(25)27/h7-14,19,24,26H,3H2,1-2,4-6H3,(H2,25,27)/b22-18+ |
| InChIKey | QHSLWTZOSGSWCD-RELWKKBWSA-N |
| XLogP | 4.94 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.58 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|