C14H15F8NO3S — CID 169110968
2,2,2-trifluoroethyl 2-[ethyl-[1-[4-(pentafluoro-λ6-sulfanyl)phenyl]ethyl]amino]-2-oxoacetate (PubChem CID 169110968) has the molecular formula C14H15F8NO3S and a molecular weight of 429.33 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2-[ethyl-[1-[4-(pentafluoro-λ6-sulfanyl)phenyl]ethyl]amino]-2-oxoacetate.
| Compound Name | 2,2,2-trifluoroethyl 2-[ethyl-[1-[4-(pentafluoro-λ6-sulfanyl)phenyl]ethyl]amino]-2-oxoacetate |
|---|---|
| PubChem CID | 169110968 |
| Molecular Formula | C14H15F8NO3S |
| Molecular Weight | 429.33 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | 2,2,2-trifluoroethyl 2-[ethyl-[1-[4-(pentafluoro-λ6-sulfanyl)phenyl]ethyl]amino]-2-oxoacetate |
| SMILES | CCN(C(=O)C(=O)OCC(F)(F)F)C(C)c1ccc(S(F)(F)(F)(F)F)cc1 |
| InChI | InChI=1S/C14H15F8NO3S/c1-3-23(12(24)13(25)26-8-14(15,16)17)9(2)10-4-6-11(7-5-10)27(18,19,20,21)22/h4-7,9H,3,8H2,1-2H3 |
| InChIKey | OJASYYKRTMBCTE-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.33 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|