C12H15F3N2O — CID 169111334
N-butyl-N-[[5-(trifluoromethyl)-2-pyridinyl]methyl]formamide (PubChem CID 169111334) has the molecular formula C12H15F3N2O and a molecular weight of 260.26 g/mol. Its IUPAC name is N-butyl-N-[[5-(trifluoromethyl)-2-pyridinyl]methyl]formamide.
| Compound Name | N-butyl-N-[[5-(trifluoromethyl)-2-pyridinyl]methyl]formamide |
|---|---|
| PubChem CID | 169111334 |
| Molecular Formula | C12H15F3N2O |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | N-butyl-N-[[5-(trifluoromethyl)-2-pyridinyl]methyl]formamide |
| SMILES | CCCCN(C=O)Cc1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C12H15F3N2O/c1-2-3-6-17(9-18)8-11-5-4-10(7-16-11)12(13,14)15/h4-5,7,9H,2-3,6,8H2,1H3 |
| InChIKey | OHMZVJCSUDPSAD-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|