C14H25NO3 — CID 169113175
tert-butyl N-[(2S)-5-cyclopropyl-2-methyl-5-oxopentyl]carbamate (PubChem CID 169113175) has the molecular formula C14H25NO3 and a molecular weight of 255.36 g/mol. Its IUPAC name is tert-butyl N-[(2S)-5-cyclopropyl-2-methyl-5-oxopentyl]carbamate.
| Compound Name | tert-butyl N-[(2S)-5-cyclopropyl-2-methyl-5-oxopentyl]carbamate |
|---|---|
| PubChem CID | 169113175 |
| Molecular Formula | C14H25NO3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | tert-butyl N-[(2S)-5-cyclopropyl-2-methyl-5-oxopentyl]carbamate |
| SMILES | C[C@@H](CCC(=O)C1CC1)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H25NO3/c1-10(5-8-12(16)11-6-7-11)9-15-13(17)18-14(2,3)4/h10-11H,5-9H2,1-4H3,(H,15,17)/t10-/m0/s1 |
| InChIKey | DSPBGEUHRJSYJR-JTQLQIEISA-N |
| XLogP | 2.91 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |