C20H32N4O — CID 169115685
2-methyl-1-[(2R,5S)-2-methyl-5-[4-(4-methylpiperazin-1-yl)phenyl]piperazin-1-yl]propan-1-one (PubChem CID 169115685) has the molecular formula C20H32N4O and a molecular weight of 344.50 g/mol. Its IUPAC name is 2-methyl-1-[(2R,5S)-2-methyl-5-[4-(4-methylpiperazin-1-yl)phenyl]piperazin-1-yl]propan-1-one.
| Compound Name | 2-methyl-1-[(2R,5S)-2-methyl-5-[4-(4-methylpiperazin-1-yl)phenyl]piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 169115685 |
| Molecular Formula | C20H32N4O |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.26 |
| IUPAC Name | 2-methyl-1-[(2R,5S)-2-methyl-5-[4-(4-methylpiperazin-1-yl)phenyl]piperazin-1-yl]propan-1-one |
| SMILES | CC(C)C(=O)N1C[C@H](c2ccc(N3CCN(C)CC3)cc2)NC[C@H]1C |
| InChI | InChI=1S/C20H32N4O/c1-15(2)20(25)24-14-19(21-13-16(24)3)17-5-7-18(8-6-17)23-11-9-22(4)10-12-23/h5-8,15-16,19,21H,9-14H2,1-4H3/t16-,19-/m1/s1 |
| InChIKey | CMNVQMCAPZKSOA-VQIMIIECSA-N |
| XLogP | 1.96 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|