C19H17FN4O — CID 169118586
2-(7-fluoro-1-oxo-2-pentylisoquinolin-6-yl)pyrimidine-5-carbonitrile (PubChem CID 169118586) has the molecular formula C19H17FN4O and a molecular weight of 336.37 g/mol. Its IUPAC name is 2-(7-fluoro-1-oxo-2-pentylisoquinolin-6-yl)pyrimidine-5-carbonitrile.
| Compound Name | 2-(7-fluoro-1-oxo-2-pentylisoquinolin-6-yl)pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 169118586 |
| Molecular Formula | C19H17FN4O |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 2-(7-fluoro-1-oxo-2-pentylisoquinolin-6-yl)pyrimidine-5-carbonitrile |
| SMILES | CCCCCn1ccc2cc(-c3ncc(C#N)cn3)c(F)cc2c1=O |
| InChI | InChI=1S/C19H17FN4O/c1-2-3-4-6-24-7-5-14-8-16(17(20)9-15(14)19(24)25)18-22-11-13(10-21)12-23-18/h5,7-9,11-12H,2-4,6H2,1H3 |
| InChIKey | OPHIZGKLBHTXCH-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 71.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|