C18H18F3N5O2 — CID 169118681
7-[4-amino-5-(difluoromethoxy)pyrimidin-2-yl]-6-fluoro-3-pentylquinazolin-4-one (PubChem CID 169118681) has the molecular formula C18H18F3N5O2 and a molecular weight of 393.37 g/mol. Its IUPAC name is 7-[4-amino-5-(difluoromethoxy)pyrimidin-2-yl]-6-fluoro-3-pentylquinazolin-4-one.
| Compound Name | 7-[4-amino-5-(difluoromethoxy)pyrimidin-2-yl]-6-fluoro-3-pentylquinazolin-4-one |
|---|---|
| PubChem CID | 169118681 |
| Molecular Formula | C18H18F3N5O2 |
| Molecular Weight | 393.37 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 7-[4-amino-5-(difluoromethoxy)pyrimidin-2-yl]-6-fluoro-3-pentylquinazolin-4-one |
| SMILES | CCCCCn1cnc2cc(-c3ncc(OC(F)F)c(N)n3)c(F)cc2c1=O |
| InChI | InChI=1S/C18H18F3N5O2/c1-2-3-4-5-26-9-24-13-7-10(12(19)6-11(13)17(26)27)16-23-8-14(15(22)25-16)28-18(20)21/h6-9,18H,2-5H2,1H3,(H2,22,23,25) |
| InChIKey | QURZNDYXKOJDGR-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.37 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|