C17H28F2N4O2 — CID 169120418
tert-butyl N-[1-[4-(1-aminoethyl)cyclohexyl]-3-(difluoromethyl)pyrazol-4-yl]carbamate (PubChem CID 169120418) has the molecular formula C17H28F2N4O2 and a molecular weight of 358.43 g/mol. Its IUPAC name is tert-butyl N-[1-[4-(1-aminoethyl)cyclohexyl]-3-(difluoromethyl)pyrazol-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[4-(1-aminoethyl)cyclohexyl]-3-(difluoromethyl)pyrazol-4-yl]carbamate |
|---|---|
| PubChem CID | 169120418 |
| Molecular Formula | C17H28F2N4O2 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.22 |
| IUPAC Name | tert-butyl N-[1-[4-(1-aminoethyl)cyclohexyl]-3-(difluoromethyl)pyrazol-4-yl]carbamate |
| SMILES | CC(N)C1CCC(n2cc(NC(=O)OC(C)(C)C)c(C(F)F)n2)CC1 |
| InChI | InChI=1S/C17H28F2N4O2/c1-10(20)11-5-7-12(8-6-11)23-9-13(14(22-23)15(18)19)21-16(24)25-17(2,3)4/h9-12,15H,5-8,20H2,1-4H3,(H,21,24) |
| InChIKey | XROZJLGJKUFGRM-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |