C30H33FN4O5S — CID 169122688
tert-butyl N-benzyl-N-[3-(1,4-dioxo-1,2,5-thiadiazolidin-2-yl)-4-fluoro-2-phenylmethoxy-5,6,7,8-tetrahydroquinolin-6-yl]carbamate (PubChem CID 169122688) has the molecular formula C30H33FN4O5S and a molecular weight of 580.68 g/mol. Its IUPAC name is tert-butyl N-benzyl-N-[3-(1,4-dioxo-1,2,5-thiadiazolidin-2-yl)-4-fluoro-2-phenylmethoxy-5,6,7,8-tetrahydroquinolin-6-yl]carbamate.
| Compound Name | tert-butyl N-benzyl-N-[3-(1,4-dioxo-1,2,5-thiadiazolidin-2-yl)-4-fluoro-2-phenylmethoxy-5,6,7,8-tetrahydroquinolin-6-yl]carbamate |
|---|---|
| PubChem CID | 169122688 |
| Molecular Formula | C30H33FN4O5S |
| Molecular Weight | 580.68 g/mol |
| Exact Mass | 580.22 |
| IUPAC Name | tert-butyl N-benzyl-N-[3-(1,4-dioxo-1,2,5-thiadiazolidin-2-yl)-4-fluoro-2-phenylmethoxy-5,6,7,8-tetrahydroquinolin-6-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(Cc1ccccc1)C1CCc2nc(OCc3ccccc3)c(N3CC(=O)NS3=O)c(F)c2C1 |
| InChI | InChI=1S/C30H33FN4O5S/c1-30(2,3)40-29(37)34(17-20-10-6-4-7-11-20)22-14-15-24-23(16-22)26(31)27(35-18-25(36)33-41(35)38)28(32-24)39-19-21-12-8-5-9-13-21/h4-13,22H,14-19H2,1-3H3,(H,33,36) |
| InChIKey | FFOJBTBQJYHCNT-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 101.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.68 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |