C29H35N3O2 — CID 58780820
tert-butyl N-benzyl-N-[4-(2,7-diazatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-2-yl)cyclohexyl]carbamate (PubChem CID 58780820) has the molecular formula C29H35N3O2 and a molecular weight of 457.62 g/mol. Its IUPAC name is tert-butyl N-benzyl-N-[4-(2,7-diazatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-2-yl)cyclohexyl]carbamate.
| Compound Name | tert-butyl N-benzyl-N-[4-(2,7-diazatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-2-yl)cyclohexyl]carbamate |
|---|---|
| PubChem CID | 58780820 |
| Molecular Formula | C29H35N3O2 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.27 |
| IUPAC Name | tert-butyl N-benzyl-N-[4-(2,7-diazatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-2-yl)cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(Cc1ccccc1)C1CCC(N2CCc3cncc4cccc2c34)CC1 |
| InChI | InChI=1S/C29H35N3O2/c1-29(2,3)34-28(33)32(20-21-8-5-4-6-9-21)25-14-12-24(13-15-25)31-17-16-23-19-30-18-22-10-7-11-26(31)27(22)23/h4-11,18-19,24-25H,12-17,20H2,1-3H3 |
| InChIKey | PINJTHAUXCVDST-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |