C15H13BrF3N3O2 — CID 169126415
6-(7-bromo-2,6,8-trifluoroquinazolin-4-yl)-1,9-dioxa-6-azaspiro[3.6]decane (PubChem CID 169126415) has the molecular formula C15H13BrF3N3O2 and a molecular weight of 404.19 g/mol. Its IUPAC name is 6-(7-bromo-2,6,8-trifluoroquinazolin-4-yl)-1,9-dioxa-6-azaspiro[3.6]decane.
| Compound Name | 6-(7-bromo-2,6,8-trifluoroquinazolin-4-yl)-1,9-dioxa-6-azaspiro[3.6]decane |
|---|---|
| PubChem CID | 169126415 |
| Molecular Formula | C15H13BrF3N3O2 |
| Molecular Weight | 404.19 g/mol |
| Exact Mass | 403.01 |
| IUPAC Name | 6-(7-bromo-2,6,8-trifluoroquinazolin-4-yl)-1,9-dioxa-6-azaspiro[3.6]decane |
| SMILES | Fc1nc(N2CCOCC3(CCO3)C2)c2cc(F)c(Br)c(F)c2n1 |
| InChI | InChI=1S/C15H13BrF3N3O2/c16-10-9(17)5-8-12(11(10)18)20-14(19)21-13(8)22-2-4-23-7-15(6-22)1-3-24-15/h5H,1-4,6-7H2 |
| InChIKey | PHQKLUJOEOYTLO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.19 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|