C15H20O2 — CID 169128153
5-tert-butyl-6-methoxy-2-methyl-2,3-dihydroinden-1-one (PubChem CID 169128153) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is 5-tert-butyl-6-methoxy-2-methyl-2,3-dihydroinden-1-one.
| Compound Name | 5-tert-butyl-6-methoxy-2-methyl-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 169128153 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | 5-tert-butyl-6-methoxy-2-methyl-2,3-dihydroinden-1-one |
| SMILES | COc1cc2c(cc1C(C)(C)C)CC(C)C2=O |
| InChI | InChI=1S/C15H20O2/c1-9-6-10-7-12(15(2,3)4)13(17-5)8-11(10)14(9)16/h7-9H,6H2,1-5H3 |
| InChIKey | BRMRKQVSHHLULF-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |