C19H21N5O2 — CID 169128997
2-benzyl-4-methyl-5-[1-(oxan-2-yl)-1,2,4-triazol-3-yl]pyridazin-3-one (PubChem CID 169128997) has the molecular formula C19H21N5O2 and a molecular weight of 351.41 g/mol. Its IUPAC name is 2-benzyl-4-methyl-5-[1-(oxan-2-yl)-1,2,4-triazol-3-yl]pyridazin-3-one.
| Compound Name | 2-benzyl-4-methyl-5-[1-(oxan-2-yl)-1,2,4-triazol-3-yl]pyridazin-3-one |
|---|---|
| PubChem CID | 169128997 |
| Molecular Formula | C19H21N5O2 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 2-benzyl-4-methyl-5-[1-(oxan-2-yl)-1,2,4-triazol-3-yl]pyridazin-3-one |
| SMILES | Cc1c(-c2ncn(C3CCCCO3)n2)cnn(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C19H21N5O2/c1-14-16(18-20-13-24(22-18)17-9-5-6-10-26-17)11-21-23(19(14)25)12-15-7-3-2-4-8-15/h2-4,7-8,11,13,17H,5-6,9-10,12H2,1H3 |
| InChIKey | UECONXYFEFKVQI-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 74.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |