C11H11N3O — CID 15722032
1-benzyl-5-methyl-1,2,4-triazin-6-one (PubChem CID 15722032) has the molecular formula C11H11N3O and a molecular weight of 201.23 g/mol. Its IUPAC name is 1-benzyl-5-methyl-1,2,4-triazin-6-one.
| Compound Name | 1-benzyl-5-methyl-1,2,4-triazin-6-one |
|---|---|
| PubChem CID | 15722032 |
| Molecular Formula | C11H11N3O |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | 1-benzyl-5-methyl-1,2,4-triazin-6-one |
| SMILES | Cc1ncnn(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C11H11N3O/c1-9-11(15)14(13-8-12-9)7-10-5-3-2-4-6-10/h2-6,8H,7H2,1H3 |
| InChIKey | FHCNMPNHIQJINN-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |