C13H18N4 — CID 84793832
3-(2-benzyl-1,2,4-triazol-3-yl)butan-1-amine (PubChem CID 84793832) has the molecular formula C13H18N4 and a molecular weight of 230.31 g/mol. Its IUPAC name is 3-(2-benzyl-1,2,4-triazol-3-yl)butan-1-amine.
| Compound Name | 3-(2-benzyl-1,2,4-triazol-3-yl)butan-1-amine |
|---|---|
| PubChem CID | 84793832 |
| Molecular Formula | C13H18N4 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 3-(2-benzyl-1,2,4-triazol-3-yl)butan-1-amine |
| SMILES | CC(CCN)c1ncnn1Cc1ccccc1 |
| InChI | InChI=1S/C13H18N4/c1-11(7-8-14)13-15-10-16-17(13)9-12-5-3-2-4-6-12/h2-6,10-11H,7-9,14H2,1H3 |
| InChIKey | CTKRXKVORYGCOD-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |