About ethyl 2-bromo-3-oxopropanoate;methoxyethane
ethyl 2-bromo-3-oxopropanoate;methoxyethane (PubChem CID 169135125) has the molecular formula C8H15BrO4
and a molecular weight of 255.11 g/mol. Its IUPAC name is ethyl 2-bromo-3-oxopropanoate;methoxyethane.
Molecular Properties
| Compound Name | ethyl 2-bromo-3-oxopropanoate;methoxyethane |
| PubChem CID | 169135125 |
| Molecular Formula | C8H15BrO4 |
| Molecular Weight | 255.11 g/mol |
| Exact Mass | 254.02 |
| IUPAC Name | ethyl 2-bromo-3-oxopropanoate;methoxyethane |
| SMILES | CCOC.CCOC(=O)C(Br)C=O |
| InChI | InChI=1S/C5H7BrO3.C3H8O/c1-2-9-5(8)4(6)3-7;1-3-4-2/h3-4H,2H2,1H3;3H2,1-2H3 |
| InChIKey | SDAMLPCWTSMPAH-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.11 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-bromo-3-oxopropanoate;methoxyethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-bromo-3-oxopropanoate;methoxyethane?
The IUPAC name of ethyl 2-bromo-3-oxopropanoate;methoxyethane (CID 169135125) is ethyl 2-bromo-3-oxopropanoate;methoxyethane.
What is the SMILES notation for ethyl 2-bromo-3-oxopropanoate;methoxyethane?
The canonical SMILES for ethyl 2-bromo-3-oxopropanoate;methoxyethane is CCOC.CCOC(=O)C(Br)C=O.
What is the InChIKey of ethyl 2-bromo-3-oxopropanoate;methoxyethane?
The InChIKey is SDAMLPCWTSMPAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7BrO3.C3H8O/c1-2-9-5(8)4(6)3-7;1-3-4-2/h3-4H,2H2,1H3;3H2,1-2H3.
What are the key properties of ethyl 2-bromo-3-oxopropanoate;methoxyethane?
ethyl 2-bromo-3-oxopropanoate;methoxyethane has a molecular weight of 255.11 g/mol, XLogP of 1.16, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-bromo-3-oxopropanoate;methoxyethane is sourced from PubChem (CID 169135125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).