C11H12B2ClNOS — CID 169137742
CID 169137742 (PubChem CID 169137742) has the molecular formula C11H12B2ClNOS and a molecular weight of 263.37 g/mol.
| Compound Name | CID 169137742 |
|---|---|
| PubChem CID | 169137742 |
| Molecular Formula | C11H12B2ClNOS |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | — |
| SMILES | [B]C1([B])COC2(CCNCC2)c2sc(Cl)cc21 |
| InChI | InChI=1S/C11H12B2ClNOS/c12-11(13)6-16-10(1-3-15-4-2-10)9-7(11)5-8(14)17-9/h5,15H,1-4,6H2 |
| InChIKey | KVEFQBPTFHJWOK-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|