C25H34N4O2S — CID 169140195
N-[3-[[(2'S,4R)-2-ethyl-2'-methylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl]methyl]cyclobutyl]-2-methylpyrimidine-4-carboxamide (PubChem CID 169140195) has the molecular formula C25H34N4O2S and a molecular weight of 454.64 g/mol. Its IUPAC name is N-[3-[[(2'S,4R)-2-ethyl-2'-methylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl]methyl]cyclobutyl]-2-methylpyrimidine-4-carboxamide.
| Compound Name | N-[3-[[(2'S,4R)-2-ethyl-2'-methylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl]methyl]cyclobutyl]-2-methylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 169140195 |
| Molecular Formula | C25H34N4O2S |
| Molecular Weight | 454.64 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | N-[3-[[(2'S,4R)-2-ethyl-2'-methylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl]methyl]cyclobutyl]-2-methylpyrimidine-4-carboxamide |
| SMILES | CCc1cc2c(s1)CCO[C@@]21CCN(CC2CC(NC(=O)c3ccnc(C)n3)C2)[C@@H](C)C1 |
| InChI | InChI=1S/C25H34N4O2S/c1-4-20-13-21-23(32-20)6-10-31-25(21)7-9-29(16(2)14-25)15-18-11-19(12-18)28-24(30)22-5-8-26-17(3)27-22/h5,8,13,16,18-19H,4,6-7,9-12,14-15H2,1-3H3,(H,28,30)/t16-,18?,19?,25+/m0/s1 |
| InChIKey | DUTPMRCEWJTDLE-GOTUEBQPSA-N |
| XLogP | 3.87 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.64 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |