C19H16BrN5OS — CID 169144863
N-[3-bromo-5-(methylsulfanylamino)phenyl]-1-(5-cyano-2-methylphenyl)pyrazole-4-carboxamide (PubChem CID 169144863) has the molecular formula C19H16BrN5OS and a molecular weight of 442.34 g/mol. Its IUPAC name is N-[3-bromo-5-(methylsulfanylamino)phenyl]-1-(5-cyano-2-methylphenyl)pyrazole-4-carboxamide.
| Compound Name | N-[3-bromo-5-(methylsulfanylamino)phenyl]-1-(5-cyano-2-methylphenyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 169144863 |
| Molecular Formula | C19H16BrN5OS |
| Molecular Weight | 442.34 g/mol |
| Exact Mass | 441.03 |
| IUPAC Name | N-[3-bromo-5-(methylsulfanylamino)phenyl]-1-(5-cyano-2-methylphenyl)pyrazole-4-carboxamide |
| SMILES | CSNc1cc(Br)cc(NC(=O)c2cnn(-c3cc(C#N)ccc3C)c2)c1 |
| InChI | InChI=1S/C19H16BrN5OS/c1-12-3-4-13(9-21)5-18(12)25-11-14(10-22-25)19(26)23-16-6-15(20)7-17(8-16)24-27-2/h3-8,10-11,24H,1-2H3,(H,23,26) |
| InChIKey | XOZSCMLJJJVJQA-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 82.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.34 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|