C17H16ClN5O3S — CID 169144957
N-[3-chloro-5-(methanesulfonamido)phenyl]-1-methyl-5-pyridin-2-ylpyrazole-3-carboxamide (PubChem CID 169144957) has the molecular formula C17H16ClN5O3S and a molecular weight of 405.87 g/mol. Its IUPAC name is N-[3-chloro-5-(methanesulfonamido)phenyl]-1-methyl-5-pyridin-2-ylpyrazole-3-carboxamide.
| Compound Name | N-[3-chloro-5-(methanesulfonamido)phenyl]-1-methyl-5-pyridin-2-ylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 169144957 |
| Molecular Formula | C17H16ClN5O3S |
| Molecular Weight | 405.87 g/mol |
| Exact Mass | 405.07 |
| IUPAC Name | N-[3-chloro-5-(methanesulfonamido)phenyl]-1-methyl-5-pyridin-2-ylpyrazole-3-carboxamide |
| SMILES | Cn1nc(C(=O)Nc2cc(Cl)cc(NS(C)(=O)=O)c2)cc1-c1ccccn1 |
| InChI | InChI=1S/C17H16ClN5O3S/c1-23-16(14-5-3-4-6-19-14)10-15(21-23)17(24)20-12-7-11(18)8-13(9-12)22-27(2,25)26/h3-10,22H,1-2H3,(H,20,24) |
| InChIKey | RNZDLNPLNQJANP-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.87 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |