C10H15F2NO — CID 169145011
1-(3,5-difluorophenoxy)-N-methylmethanamine;ethane (PubChem CID 169145011) has the molecular formula C10H15F2NO and a molecular weight of 203.23 g/mol. Its IUPAC name is 1-(3,5-difluorophenoxy)-N-methylmethanamine;ethane.
| Compound Name | 1-(3,5-difluorophenoxy)-N-methylmethanamine;ethane |
|---|---|
| PubChem CID | 169145011 |
| Molecular Formula | C10H15F2NO |
| Molecular Weight | 203.23 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 1-(3,5-difluorophenoxy)-N-methylmethanamine;ethane |
| SMILES | CC.CNCOc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C8H9F2NO.C2H6/c1-11-5-12-8-3-6(9)2-7(10)4-8;1-2/h2-4,11H,5H2,1H3;1-2H3 |
| InChIKey | FMSBLMFUNXKSQO-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.23 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|