C12H15NO3S — CID 169145049
2-(benzenesulfonyl)-1-[(2S)-pyrrolidin-2-yl]ethanone (PubChem CID 169145049) has the molecular formula C12H15NO3S and a molecular weight of 253.32 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-1-[(2S)-pyrrolidin-2-yl]ethanone.
| Compound Name | 2-(benzenesulfonyl)-1-[(2S)-pyrrolidin-2-yl]ethanone |
|---|---|
| PubChem CID | 169145049 |
| Molecular Formula | C12H15NO3S |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | 2-(benzenesulfonyl)-1-[(2S)-pyrrolidin-2-yl]ethanone |
| SMILES | O=C(CS(=O)(=O)c1ccccc1)[C@@H]1CCCN1 |
| InChI | InChI=1S/C12H15NO3S/c14-12(11-7-4-8-13-11)9-17(15,16)10-5-2-1-3-6-10/h1-3,5-6,11,13H,4,7-9H2/t11-/m0/s1 |
| InChIKey | POKLGCWCCMUMNS-NSHDSACASA-N |
| XLogP | 0.78 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |