C12H14NO3PdS- — CID 169145052
2-(benzenesulfonyl)-1-pyrrolidin-1-id-2-ylethanone;palladium (PubChem CID 169145052) has the molecular formula C12H14NO3PdS- and a molecular weight of 358.74 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-1-pyrrolidin-1-id-2-ylethanone;palladium.
| Compound Name | 2-(benzenesulfonyl)-1-pyrrolidin-1-id-2-ylethanone;palladium |
|---|---|
| PubChem CID | 169145052 |
| Molecular Formula | C12H14NO3PdS- |
| Molecular Weight | 358.74 g/mol |
| Exact Mass | 357.97 |
| IUPAC Name | 2-(benzenesulfonyl)-1-pyrrolidin-1-id-2-ylethanone;palladium |
| SMILES | O=C(CS(=O)(=O)c1ccccc1)C1CCC[N-]1.[Pd] |
| InChI | InChI=1S/C12H14NO3S.Pd/c14-12(11-7-4-8-13-11)9-17(15,16)10-5-2-1-3-6-10;/h1-3,5-6,11H,4,7-9H2;/q-1; |
| InChIKey | QZGBXRDIFBJHAO-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 65.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.74 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |