C12H15N3O — CID 169150932
2-(3,4-dihydro-2H-1,4-benzoxazin-6-yl)cyclopropane-1-carboximidamide (PubChem CID 169150932) has the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-1,4-benzoxazin-6-yl)cyclopropane-1-carboximidamide.
| Compound Name | 2-(3,4-dihydro-2H-1,4-benzoxazin-6-yl)cyclopropane-1-carboximidamide |
|---|---|
| PubChem CID | 169150932 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 2-(3,4-dihydro-2H-1,4-benzoxazin-6-yl)cyclopropane-1-carboximidamide |
| SMILES | [H]/N=C(\N)C1CC1c1ccc2c(c1)NCCO2 |
| InChI | InChI=1S/C12H15N3O/c13-12(14)9-6-8(9)7-1-2-11-10(5-7)15-3-4-16-11/h1-2,5,8-9,15H,3-4,6H2,(H3,13,14) |
| InChIKey | FLMCNLQMKJWFDI-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 71.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|