C13H18N2 — CID 169153064
2-methyl-6-(6-methyl-3-pyridinyl)-6-azabicyclo[3.1.1]heptane (PubChem CID 169153064) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 2-methyl-6-(6-methyl-3-pyridinyl)-6-azabicyclo[3.1.1]heptane.
| Compound Name | 2-methyl-6-(6-methyl-3-pyridinyl)-6-azabicyclo[3.1.1]heptane |
|---|---|
| PubChem CID | 169153064 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 2-methyl-6-(6-methyl-3-pyridinyl)-6-azabicyclo[3.1.1]heptane |
| SMILES | Cc1ccc(N2C3CCC(C)C2C3)cn1 |
| InChI | InChI=1S/C13H18N2/c1-9-3-5-11-7-13(9)15(11)12-6-4-10(2)14-8-12/h4,6,8-9,11,13H,3,5,7H2,1-2H3 |
| InChIKey | KMLYBPCEEPLSEV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |