C36H45BN6O2S — CID 169153382
CID 169153382 (PubChem CID 169153382) has the molecular formula C36H45BN6O2S and a molecular weight of 636.68 g/mol.
| Compound Name | CID 169153382 |
|---|---|
| PubChem CID | 169153382 |
| Molecular Formula | C36H45BN6O2S |
| Molecular Weight | 636.68 g/mol |
| Exact Mass | 636.34 |
| IUPAC Name | — |
| SMILES | CC.[B]c1cc2c(=O)c(CN(Cc3ccnc(OC)c3)C3CCCN(c4ccc(NCC5CC5)nc4)C3)cn3c2c(c1C)SCC3 |
| InChI | InChI=1S/C34H39BN6O2S.C2H6/c1-22-29(35)15-28-32-34(22)44-13-12-40(32)19-25(33(28)42)20-41(18-24-9-10-36-31(14-24)43-2)27-4-3-11-39(21-27)26-7-8-30(38-17-26)37-16-23-5-6-23;1-2/h7-10,14-15,17,19,23,27H,3-6,11-13,16,18,20-21H2,1-2H3,(H,37,38);1-2H3 |
| InChIKey | RLQQRZDIQKVTSG-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 75.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.68 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|